For research use only. Not for therapeutic Use.
Flubendazole(Cat No.:A000371)is a broad-spectrum anthelmintic used primarily for the treatment of parasitic worm infections, including ascariasis, hookworm, and whipworm. It works by inhibiting microtubule polymerization in the cells of the parasites, leading to disruption of their ability to absorb glucose, resulting in their death. Flubendazole is often used in veterinary medicine and is also being explored for potential use in treating certain types of cancer due to its anti-proliferative effects. Its low toxicity profile in humans makes it a favorable option for parasitic infections.
CAS Number | 31430-15-6 |
Synonyms | Flumoxanal, NSC 313680 |
Molecular Formula | C16H12FN3O3 |
Purity | ≥95% |
Target | Cytoskeleton |
Storage | 3 years -20C powder |
IUPAC Name | methyl N-[6-(4-fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate |
InChI | InChI=1S/C16H12FN3O3/c1-23-16(22)20-15-18-12-7-4-10(8-13(12)19-15)14(21)9-2-5-11(17)6-3-9/h2-8H,1H3,(H2,18,19,20,22) |
InChIKey | CPEUVMUXAHMANV-UHFFFAOYSA-N |
SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=C(C=C3)F |