For research use only. Not for therapeutic Use.
Flubendazole-d3 (Cat No.:C000663) is a deuterium-labeled derivative of flubendazole, a benzimidazole anthelmintic used to treat various parasitic infections. Deuterium substitution enhances molecular stability and provides a labeled version for research purposes. Flubendazole acts by disrupting the microtubule structure in parasites, inhibiting their growth and reproduction. The deuterium labeling allows for precise tracking and analysis, contributing to a deeper understanding of flubendazole’s mechanism of action and potential applications in controlling parasitic diseases.
| Catalog Number | C000663 |
| CAS Number | 1173021-08-3 |
| Synonyms | Trideuteriomethyl N-[5-(4-Fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate |
| Molecular Formula | C₁₆H₉D₃FN₃O₃ |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| Appearance | Off-White to Pale Brown Solid |
| Storage | -20°C |
| IUPAC Name | trideuteriomethyl N-[6-(4-fluorobenzoyl)-1H-benzimidazol-2-yl]carbamate |
| InChI | InChI=1S/C16H12FN3O3/c1-23-16(22)20-15-18-12-7-4-10(8-13(12)19-15)14(21)9-2-5-11(17)6-3-9/h2-8H,1H3,(H2,18,19,20,22)/i1D3 |
| InChIKey | CPEUVMUXAHMANV-FIBGUPNXSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=C(C=C3)F |
| Reference | Thienpont, D., et al.: Arzneimittel-Forsch., 28, 605 (1978), Vanparijs, O., et al.: Vet. Parasitol, 5, 237 (1979), |
