For research use only. Not for therapeutic Use.
Fluchloralin（Cat No.:R069444）is called BAS 3920;BAS 3921;BAS 3921 H;BAS 3922;BAS 3924H.Fluchloralin is often used as an analytical standard and sometimes as a pesticide, but it is extremely toxic to aquatic organisms and may have long-term adverse effects on the water environment.
| Catalog Number | R069444 |
| CAS Number | 33245-39-5 |
| Molecular Formula | C12H13ClF3N3O4 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | N-(2-chloroethyl)-2,6-dinitro-N-propyl-4-(trifluoromethyl)aniline |
| InChI | InChI=1S/C12H13ClF3N3O4/c1-2-4-17(5-3-13)11-9(18(20)21)6-8(12(14,15)16)7-10(11)19(22)23/h6-7H,2-5H2,1H3 |
| InChIKey | MNFMIVVPXOGUMX-UHFFFAOYSA-N |
| SMILES | CCCN(CCCl)C1=C(C=C(C=C1[N+](=O)[O-])C(F)(F)F)[N+](=O)[O-] |
