For research use only. Not for therapeutic Use.
Fludarabine(Cat No.:A001054)is a synthetic purine nucleoside analog used primarily in the treatment of hematological malignancies, particularly chronic lymphocytic leukemia (CLL) and non-Hodgkin lymphoma. It acts by interfering with DNA synthesis and repair, ultimately leading to apoptosis in rapidly dividing cancer cells. Fludarabine is often administered in combination with other chemotherapy agents to enhance therapeutic efficacy. Its effectiveness is attributed to its ability to inhibit ribonucleotide reductase and DNA polymerase, disrupting the cell cycle. Ongoing research continues to explore its potential in combination therapies and its mechanisms in various cancers.
CAS Number | 21679-14-1 |
Synonyms | FaraA, Fludarabinum |
Molecular Formula | C10H12FN5O4 |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | >9.3mg/mL in DMSO |
Storage | -20 ℃ |
IUPAC Name | (2R,3S,4S,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
InChI | InChI=1S/C10H12FN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6+,9-/m1/s1 |
InChIKey | HBUBKKRHXORPQB-FJFJXFQQSA-N |
SMILES | C1=NC2=C(N=C(N=C2N1[C@H]3[C@H]([C@@H]([C@H](O3)CO)O)O)F)N |