For research use only. Not for therapeutic Use.
Fludarabine-Cl has inhibition effect on RNA adenosine deaminase 1(ADAR1), and can be used for preventing and/or researching cancer or tumor-related diseases[1].
| Catalog Number | I044015 |
| CAS Number | 2734853-80-4 |
| Synonyms | (2R,3R,4S,5S)-2-(6-amino-2-fluoropurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol |
| Molecular Formula | C10H11ClFN5O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C10H11ClFN5O3/c11-1-3-5(18)6(19)9(20-3)17-2-14-4-7(13)15-10(12)16-8(4)17/h2-3,5-6,9,18-19H,1H2,(H2,13,15,16)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | HSCKXTNMVCTWGY-UUOKFMHZSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CCl)O)O)F)N |
| Reference | [1]. Polysubstituted purine compound and preparation method and application thereof. CN113549076A. |
