For research use only. Not for therapeutic Use.
Fludrocortisone acetate(Cat No.:I003851)is a synthetic corticosteroid with potent mineralocorticoid activity, primarily used to treat adrenal insufficiency, such as Addison’s disease. By mimicking aldosterone, it helps regulate sodium retention, potassium excretion, and fluid balance, which are essential for maintaining blood pressure and electrolyte stability. Fludrocortisone acetate’s role in managing orthostatic hypotension also makes it useful in specific cases of low blood pressure. Due to its powerful mineralocorticoid effects, dosing requires careful monitoring to prevent side effects like fluid retention, making it effective yet precise for endocrine therapy.
CAS Number | 514-36-3 |
Molecular Formula | C23H31FO6 |
Purity | ≥95% |
Target | Vitamin D Related/Nuclear Receptor |
Solubility | DMSO:45mg/mL |
Storage | 3 years -20℃ powder |
IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,17R)-9-fluoro-11,17-dihydroxy-10,13-dimethyl-3-oxo-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
InChI | InChI=1S/C23H31FO6/c1-13(25)30-12-19(28)22(29)9-7-16-17-5-4-14-10-15(26)6-8-20(14,2)23(17,24)18(27)11-21(16,22)3/h10,16-18,27,29H,4-9,11-12H2,1-3H3/t16-,17-,18-,20-,21-,22-,23-/m0/s1 |
InChIKey | SYWHXTATXSMDSB-GSLJADNHSA-N |
SMILES | CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)CC[C@@]43C)F)O)C)O |
Reference | <p style=/line-height:25px/> |