For research use only. Not for therapeutic Use.
Fluocinolone is a corticosteroid that is used to relieve redness, itching, swelling, or other discomfort caused by skin conditions[1].
| Catalog Number | R018703 |
| CAS Number | 807-38-5 |
| Synonyms | (6S,8S,9R,10S,11S,13S,14S,16R,17S)-6,9-difluoro-11,16,17-trihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| Molecular Formula | C21H26F2O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H26F2O6/c1-18-4-3-10(25)5-13(18)14(22)6-12-11-7-15(26)21(29,17(28)9-24)19(11,2)8-16(27)20(12,18)23/h3-5,11-12,14-16,24,26-27,29H,6-9H2,1-2H3/t11-,12-,14-,15+,16-,18-,19-,20-,21-/m0/s1 |
| InChIKey | UUOUOERPONYGOS-CLCRDYEYSA-N |
| SMILES | CC12CC(C3(C(C1CC(C2(C(=O)CO)O)O)CC(C4=CC(=O)C=CC43C)F)F)O |
| Reference | [1]. Y Aizawa, et al. Effect of difluprednate on adrenocortical and gonadal function]. Nihon Yakurigaku Zasshi. 1984 Dec;84(6):553-61. |
