For research use only. Not for therapeutic Use.
Fluorene-9,9-dipropionic acid(Cat No.:L024784)is an aromatic compound featuring a fluorene core with two propionic acid groups attached at the 9-position. This compound is widely used in materials science, polymer chemistry, and pharmaceutical research. Its structure makes it a valuable building block for the synthesis of fluorescent materials, polymers, and advanced organic compounds. The propionic acid groups allow for further functionalization, enabling the development of novel materials with unique properties. With high purity and stability, fluorene-9,9-dipropionic acid is essential for applications in advanced research and product development.
CAS Number | 4425-95-0 |
Molecular Formula | C19H18O4 |
Purity | ≥95% |
IUPAC Name | 3-[9-(2-carboxyethyl)fluoren-9-yl]propanoic acid |
InChI | InChI=1S/C19H18O4/c20-17(21)9-11-19(12-10-18(22)23)15-7-3-1-5-13(15)14-6-2-4-8-16(14)19/h1-8H,9-12H2,(H,20,21)(H,22,23) |
InChIKey | HVIAEALBBMNFIW-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2(CCC(=O)O)CCC(=O)O |