For research use only. Not for therapeutic Use.
<span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">Fluorene (CAS 86-73-7) <span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">was used study the extraction of specific, semiconducting single-wall carbon nanotubes (SWCNTs).</span></span></span></span>
| Catalog Number | R050535 |
| CAS Number | 86-73-7 |
| Synonyms | 9H-Fluorene; 2,2’-Methylenebiphenyl; Diphenylenemethane; NSC 6787; o-Biphenylenemethane; |
| Molecular Formula | C13H10 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 9H-fluorene |
| InChI | InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
| InChIKey | NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=CC=CC=C31 |
| Reference | <span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">1.<span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Tange, Masayoshi, Toshiya Okazaki, and Sumio Iijima. "Influence of structure-selective fluorene-based polymer wrapping on optical transitions of single-wall carbon nanotubes." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Nanoscale</i><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> 6.1 (2014): 248-254.</span></span></span></span> |
