For research use only. Not for therapeutic Use.
Fluorescein Cadaverine is a fluorescent probe commonly used in biochemical and molecular biology research. It combines the bright fluorescence of fluorescein with the reactive amine group of cadaverine, enabling its use in labeling and detecting biomolecules. This compound is particularly valuable in studying protein interactions, cell surface labeling, and enzyme activities. Its high sensitivity and specificity make it an essential tool for imaging and tracking biological processes, providing clear and precise visualization in various experimental setups.
| Catalog Number | R072026 |
| CAS Number | 786705-84-8 |
| Molecular Formula | C26H27Br2N3O5S |
| Purity | ≥95% |
| IUPAC Name | 1-(5-aminopentyl)-3-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)thiourea |
| InChI | InChI=1S/C26H25N3O5S/c27-10-2-1-3-11-28-25(35)29-15-4-7-19-18(12-15)24(32)34-26(19)20-8-5-16(30)13-22(20)33-23-14-17(31)6-9-21(23)26/h4-9,12-14,30-31H,1-3,10-11,27H2,(H2,28,29,35) |
| InChIKey | LVNZXNJCCZJIME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=S)NCCCCCN)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
