For research use only. Not for therapeutic Use.
Fluorescein (Solvent Yellow 94)(Cat No.:M116415)is a synthetic organic compound widely used as a fluorescent tracer in various scientific and medical applications. Known for its vibrant yellow-green fluorescence, it is essential in ophthalmology for diagnosing corneal abrasions and retinal issues. In environmental studies, fluorescein tracks water flow and detects leaks. Additionally, it serves as a dye in microscopy, flow cytometry, and forensic science. Its high visibility and safety profile make fluorescein a versatile and invaluable tool across multiple disciplines, enhancing diagnostic accuracy and research capabilities.
CAS Number | 518-45-6 |
Synonyms | 126605-73-0; |
Molecular Formula | C20H12O5 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
InChI | InChI=1S/C20H12O5/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24/h1-10,21H,(H,23,24) |
InChIKey | YKGGGCXBWXHKIZ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=C3C=CC(=O)C=C3OC4=C2C=CC(=C4)O)C(=O)O |