For research use only. Not for therapeutic Use.
Fluphenazine-d8 dihydrochloride（Cat No.:S000323） is a deuterated version of fluphenazine dihydrochloride, where eight hydrogen atoms are replaced with deuterium. This substitution enhances its chemical stability, making it valuable as an analytical standard, particularly in mass spectrometry and NMR spectroscopy. Fluphenazine is a potent antipsychotic medication belonging to the phenothiazine class, primarily used to treat schizophrenia. It functions by blocking dopamine receptors in the brain. The deuterated form allows researchers to precisely study the drug’s pharmacokinetics, metabolism, and molecular interactions, providing clearer insights into its behavior in biological systems.
| Catalog Number | S000323 |
| CAS Number | 1323633-98-2 |
| Molecular Formula | C22H20D8Cl2F3N3OS |
| Purity | ≥95% |
| IUPAC Name | 2-[2,2,3,3,5,5,6,6-octadeuterio-4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol |
| InChI | InChI=1S/C22H26F3N3OS/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29/h1-2,4-7,16,29H,3,8-15H2/i10D2,11D2,12D2,13D2 |
| InChIKey | PLDUPXSUYLZYBN-BGKXKQMNSA-N |
| SMILES | C1CN(CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F)CCO |
