For research use only. Not for therapeutic Use.
Fluphenazine dihydrochloride(CAT: A000082) is an antipsychotic medication belonging to the class of phenothiazines. It is primarily used to manage symptoms of schizophrenia and other psychotic disorders by blocking dopamine receptors in the brain, particularly the D2 receptors, which helps reduce delusions, hallucinations, and disorganized thinking. Fluphenazine dihydrochloride is known for its potent antipsychotic effects and long-acting formulations, making it suitable for patients requiring sustained symptom control. Common side effects include sedation, extrapyramidal symptoms (such as muscle stiffness and tremors), and weight gain. It is often administered as oral tablets or injections, depending on the treatment requirements.
| Catalog Number | A000082 |
| CAS Number | 146-56-5 |
| Synonyms | 2-[4-[3-[2-(trifluoromethyl)phenothiazin-10-yl]propyl]piperazin-1-yl]ethanol;dihydrochloride |
| Molecular Formula | C22H28Cl2F3N3OS |
| Purity | ≥95% |
| InChI | InChI=1S/C22H26F3N3OS.2ClH/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29;;/h1-2,4-7,16,29H,3,8-15H2;2*1H |
| InChIKey | MBHNWCYEGXQEIT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F)CCO.Cl.Cl |
