For research use only. Not for therapeutic Use.
Flurandrenolide(CAT: I001894) is a synthetic glucocorticoid with potent anti-inflammatory and immunosuppressive properties. It is widely utilized in research focusing on inflammatory diseases, immune response modulation, and glucocorticoid receptor signaling pathways. By reducing the production of pro-inflammatory mediators, Flurandrenolide aids in studying the mechanisms of inflammation and its therapeutic control. Its high purity and consistent activity ensure reliable experimental outcomes, making it an invaluable tool for investigating corticosteroid actions and potential therapeutic applications in dermatology, immunology, and related fields.
| Catalog Number | I001894 |
| CAS Number | 1524-88-5 |
| Synonyms | Fludroxycortide;Flurandrenolone;L-33,379 |
| Molecular Formula | C24H33FO6 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | (1S,2S,4R,8S,9S,11S,12S,13R,19S)-19-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-6,6,9,13-tetramethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icos-17-en-16-one |
| InChI | InChI=1S/C24H33FO6/c1-21(2)30-19-9-14-13-8-16(25)15-7-12(27)5-6-22(15,3)20(13)17(28)10-23(14,4)24(19,31-21)18(29)11-26/h7,13-14,16-17,19-20,26,28H,5-6,8-11H2,1-4H3/t13-,14-,16-,17-,19+,20+,22-,23-,24+/m0/s1 |
| InChIKey | POPFMWWJOGLOIF-XWCQMRHXSA-N |
| SMILES | C[C@]12CCC(=O)C=C1[C@H](C[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3C[C@@H]5[C@]4(OC(O5)(C)C)C(=O)CO)C)O)F |
