For research use only. Not for therapeutic Use.
Flurofamide（Cat No.:I010217）is a potent and selective fluorine-containing amide compound, primarily used in pharmaceutical and biochemical research. It has demonstrated promising bioactivity in various therapeutic areas, including cancer and inflammation. Flurofamide’s mechanism of action involves the inhibition of specific enzymes or signaling pathways, making it a valuable tool in drug discovery. Due to its structural features, it also shows potential in designing more effective and targeted treatments. With high purity and stability, Flurofamide is an essential compound for advanced research in medicinal chemistry and biochemistry.
| Catalog Number | I010217 |
| CAS Number | 70788-28-2 |
| Synonyms | N-(Diaminophosphinyl)-4-fluorobenzamide |
| Molecular Formula | C7H9FN3O2P |
| Purity | ≥95% |
| Target | Bacterial |
| Solubility | Soluble to 50 mM in DMSO |
| Storage | Store at RT |
| IUPAC Name | N-diaminophosphoryl-4-fluorobenzamide |
| InChI | InChI=1S/C7H9FN3O2P/c8-6-3-1-5(2-4-6)7(12)11-14(9,10)13/h1-4H,(H5,9,10,11,12,13) |
| InChIKey | QWZFVMCWPLMLTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NP(=O)(N)N)F |
