For research use only. Not for therapeutic Use.
Fluxapyroxad (Cat No.:R069606) is a synthetic fungicide used to protect crops from fungal diseases. It belongs to the pyrazole carboxamide class. By inhibiting the mitochondrial respiratory complex II in fungi, it disrupts their energy production and leads to their demise. This fungicidal action makes it effective against diseases like powdery mildew, leaf spots, and rusts in various crops. Fluxapyroxad plays a crucial role in agriculture, enhancing crop protection and productivity by mitigating the impact of fungal infections, ensuring healthier yields and sustainable farming practices.
| Catalog Number | R069606 |
| CAS Number | 907204-31-3 |
| Synonyms | XEMIUM® |
| Molecular Formula | C18H12F5N3O |
| Purity | ≥95% |
| Target | Fungal |
| Storage | Store at -20°C |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-N-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide |
| InChI | InChI=1S/C18H12F5N3O/c1-26-8-11(16(25-26)17(22)23)18(27)24-14-5-3-2-4-10(14)9-6-12(19)15(21)13(20)7-9/h2-8,17H,1H3,(H,24,27) |
| InChIKey | SXSGXWCSHSVPGB-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)F)C(=O)NC2=CC=CC=C2C3=CC(=C(C(=C3)F)F)F |
