For research use only. Not for therapeutic Use.
FMC 23509(Cat No.:I027653)is a chemical compound that has been explored for its potential pharmacological applications, particularly in the field of cancer research. It is a synthetic molecule with properties that may inhibit specific enzymes or pathways involved in tumor growth and proliferation. FMC 23509 is part of a broader effort to identify and develop novel cancer therapies targeting molecular mechanisms associated with cellular regulation and tumorigenesis. While the compound’s full therapeutic potential is still under investigation, early research suggests it could serve as a lead compound for the development of new anticancer drugs.
CAS Number | 32795-74-7 |
Synonyms | FMC 23509; Crd 9499; Juvenile hormone analog fmc 23509; FMC-23509; FMC23509; |
Molecular Formula | C17H29NO2 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-N-ethyl-3,7-dimethylnona-2,6-dienamide |
InChI | InChI=1S/C17H29NO2/c1-6-18-16(19)12-14(3)9-7-8-13(2)10-11-15-17(4,5)20-15/h8,12,15H,6-7,9-11H2,1-5H3,(H,18,19)/b13-8+,14-12+ |
InChIKey | MSUGIXBDDWIMPG-LMLHBTEYSA-N |
SMILES | CCNC(=O)/C=C(\C)/CC/C=C(\C)/CCC1C(O1)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |