For research use only. Not for therapeutic Use.
Fmoc-1(1-boc-piperidin-4-yl)-DL-glycine(Cat No.:L021385)is a protected amino acid derivative used in peptide synthesis and pharmaceutical research. The molecule features a glycine backbone with an Fmoc (fluorenylmethyloxycarbonyl) protecting group on the amino end and a Boc (tert-butyloxycarbonyl) protected piperidinyl group attached to the glycine side chain. This dual protection allows for selective deprotection and incorporation into peptide sequences, making it valuable for creating complex peptides and proteins. Its structure is essential for researchers focused on drug discovery, medicinal chemistry, and the development of therapeutic peptides.
CAS Number | 204058-24-2 |
Molecular Formula | C27H32N2O6 |
Purity | ≥95% |
IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid |
InChI | InChI=1S/C27H32N2O6/c1-27(2,3)35-26(33)29-14-12-17(13-15-29)23(24(30)31)28-25(32)34-16-22-20-10-6-4-8-18(20)19-9-5-7-11-21(19)22/h4-11,17,22-23H,12-16H2,1-3H3,(H,28,32)(H,30,31)/t23-/m0/s1 |
InChIKey | ATJZZVCJRHLAGA-QHCPKHFHSA-N |
SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |