For research use only. Not for therapeutic Use.
FMOC-4-Aminomethyl-phenylacetic acid(Cat No.:M042597)is a protected amino acid derivative commonly used in peptide synthesis and pharmaceutical research. The compound features a 9-fluorenylmethoxycarbonyl (FMOC) group protecting the amino function, along with a phenylacetic acid backbone, making it ideal for use in solid-phase peptide synthesis (SPPS). Its structure allows for the efficient incorporation of the phenylacetic acid moiety into peptides, which is crucial in the development of therapeutic peptides and protein-based drugs. FMOC-4-Aminomethyl-phenylacetic acid is essential for researchers focused on advanced peptide chemistry and drug development.
CAS Number | 176504-01-1 |
Molecular Formula | C24H21NO4 |
Purity | ≥95% |
IUPAC Name | 2-[4-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]acetic acid |
InChI | InChI=1S/C24H21NO4/c26-23(27)13-16-9-11-17(12-10-16)14-25-24(28)29-15-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22H,13-15H2,(H,25,28)(H,26,27) |
InChIKey | SKKYGLCUQGQTNA-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=C(C=C4)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |