For research use only. Not for therapeutic Use.
Fmoc-Ala-Ser(psi(Me, Me)pro)-OH（Cat No.:I007911） is a dipeptide composed of two amino acids: alanine (Ala) and serine (Ser) with a psi(Me, Me)pro modification. The N-terminal amino acid, alanine, is protected by the Fmoc group, while the serine residue is modified with a psi(Me, Me)pro group. The C-terminus of the dipeptide contains a carboxylic acid group (OH). This dipeptide can be utilized in peptide synthesis, drug development, or other biochemical research applications where the specific sequence and modified amino acid are of interest.
| Catalog Number | I007911 |
| CAS Number | 252554-78-2 |
| Molecular Formula | C₂₄H₂₆N₂O₆ |
| Purity | ≥95% |
| IUPAC Name | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChI | InChI=1S/C24H26N2O6/c1-14(21(27)26-20(22(28)29)13-32-24(26,2)3)25-23(30)31-12-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,14,19-20H,12-13H2,1-3H3,(H,25,30)(H,28,29)/t14-,20-/m0/s1 |
| InChIKey | QMRGOZHWQFEGGB-XOBRGWDASA-N |
| SMILES | CC(C(=O)N1C(COC1(C)C)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
