For research use only. Not for therapeutic Use.
FMOC-D-3,4-Difluorophenylalanine (FMOC-D-3,4-DFP) is a derivative of the amino acid phenylalanine, modified with a fluorine atom at the 3 and 4 positions of the aromatic ring. The FMOC (fluorenylmethyloxycarbonyl) group protects the amino functionality, facilitating peptide synthesis. This compound is of interest in medicinal chemistry and biochemistry for its potential applications in developing fluorinated peptides and studying the effects of fluorination on biological activity. Its unique structural properties make it valuable for drug discovery and the design of new therapeutic agents.
CAS Number | 198545-59-4 |
Molecular Formula | C24H19F2NO4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R)-3-(3,4-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
InChI | InChI=1S/C24H19F2NO4/c25-20-10-9-14(11-21(20)26)12-22(23(28)29)27-24(30)31-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-11,19,22H,12-13H2,(H,27,30)(H,28,29)/t22-/m1/s1 |
InChIKey | IHSYIDJNVXPQRM-JOCHJYFZSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC(=C(C=C4)F)F)C(=O)O |