For research use only. Not for therapeutic Use.
Fmoc-D-cis-hyp-OH, or Fmoc-D-cis-4-hydroxyproline, is a protected amino acid derivative characterized by the presence of an Fmoc (9-fluorenylmethoxycarbonyl) group that shields the amino functionality. This compound features a cis configuration at the 4-position, contributing to its unique structural properties. Fmoc-D-cis-hyp-OH is valuable in peptide synthesis, particularly in producing cyclic peptides and modifying the conformational properties of peptides. Its distinctive structure aids in developing bioactive compounds and exploring the relationship between peptide structure and function.
CAS Number | 214852-45-6 |
Molecular Formula | C20H19NO5 |
Purity | ≥95% |
IUPAC Name | (2R,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C20H19NO5/c22-12-9-18(19(23)24)21(10-12)20(25)26-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17-18,22H,9-11H2,(H,23,24)/t12-,18-/m1/s1 |
InChIKey | GOUUPUICWUFXPM-KZULUSFZSA-N |
SMILES | C1[C@H](CN([C@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |