For research use only. Not for therapeutic Use.
Fmoc-D-Lys(N3)-OH is a click chemistry reagent containing an azide group. Fmoc-D-Lys(N3)-OH can be used for the research of various biochemical[1].
Catalog Number | I042597 |
CAS Number | 1198791-53-5 |
Synonyms | (2R)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
Molecular Formula | C21H22N4O4 |
Purity | ≥95% |
InChI | InChI=1S/C21H22N4O4/c22-25-23-12-6-5-11-19(20(26)27)24-21(28)29-13-18-16-9-3-1-7-14(16)15-8-2-4-10-17(15)18/h1-4,7-10,18-19H,5-6,11-13H2,(H,24,28)(H,26,27)/t19-/m1/s1 |
InChIKey | PJRFTUILPGJJIO-LJQANCHMSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCCCN=[N+]=[N-])C(=O)O |
Reference | [1]. Sminia, et al. Azide- and alkyne-functionalized α- and β3-amino acids. Synlett |