For research use only. Not for therapeutic Use.
FMOC-D-Tyr(Bzl)-OH(Cat No.:M118120)is a protected form of D-tyrosine, where the tyrosine residue is modified with a benzyl (Bzl) group on the hydroxyl side chain and an FMOC (9-fluorenylmethyloxycarbonyl) group on the amino terminus. This compound is essential in solid-phase peptide synthesis, particularly for creating peptides with specific biological activities. The FMOC group serves as a temporary protecting group during synthesis, while the benzyl group protects the tyrosine side chain. High purity and stability make FMOC-D-Tyr(Bzl)-OH a crucial component in advanced peptide chemistry and research.
CAS Number | 138775-48-1 |
Molecular Formula | C31H27NO5 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
InChI | InChI=1S/C31H27NO5/c33-30(34)29(18-21-14-16-23(17-15-21)36-19-22-8-2-1-3-9-22)32-31(35)37-20-28-26-12-6-4-10-24(26)25-11-5-7-13-27(25)28/h1-17,28-29H,18-20H2,(H,32,35)(H,33,34)/t29-/m1/s1 |
InChIKey | REHSJSKPWIOKIJ-GDLZYMKVSA-N |
SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CC(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |