For research use only. Not for therapeutic Use.
FMOC-DAP(ALOC)-OH is a derivative of diaminopropionic acid (DAP), featuring an FMOC (fluorenylmethyloxycarbonyl) protective group on the amine and an allyloxycarbonyl (ALOC) protecting group on the side-chain amine. This compound is commonly used in peptide synthesis to protect specific amino groups during sequential coupling reactions. The FMOC group can be removed under mild conditions, enabling selective deprotection. FMOC-DAP(ALOC)-OH is valuable for creating complex peptide structures in medicinal chemistry, facilitating the development of bioactive peptides and therapeutic agents.
Catalog Number | M040075 |
CAS Number | 188970-92-5 |
Molecular Formula | C22H22N2O6 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(prop-2-enoxycarbonylamino)propanoic acid |
InChI | InChI=1S/C22H22N2O6/c1-2-11-29-21(27)23-12-19(20(25)26)24-22(28)30-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,18-19H,1,11-13H2,(H,23,27)(H,24,28)(H,25,26)/t19-/m0/s1 |
InChIKey | MPVGCCAXXFLGIU-IBGZPJMESA-N |
SMILES | C=CCOC(=O)NCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |