For research use only. Not for therapeutic Use.
Fmoc-Gly-Gly-Phe-Gly-NH-CH2-O-CO-CH3 (Cat No.: I040124) is a peptide derivative used in peptide synthesis and research. The Fmoc (9-fluorenylmethoxycarbonyl) group is a common protecting group used to prevent unwanted reactions during peptide assembly. This compound contains a sequence of glycine (Gly), phenylalanine (Phe), and another glycine, linked through an amide bond. The ester group (CO-CH3) attached to the terminal amine may be used for further functionalization or conjugation. It can serve as a model or intermediate in the synthesis of bioactive peptides or drug delivery systems.
CAS Number | 2866301-96-2 |
Synonyms | [[2-[[(2S)-2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]-3-phenylpropanoyl]amino]acetyl]amino]methyl acetate |
Molecular Formula | C33H35N5O8 |
Purity | ≥95% |
InChI | InChI=1S/C33H35N5O8/c1-21(39)46-20-37-30(41)16-35-32(43)28(15-22-9-3-2-4-10-22)38-31(42)18-34-29(40)17-36-33(44)45-19-27-25-13-7-5-11-23(25)24-12-6-8-14-26(24)27/h2-14,27-28H,15-20H2,1H3,(H,34,40)(H,35,43)(H,36,44)(H,37,41)(H,38,42)/t28-/m0/s1 |
InChIKey | XWQQDGZCBPDSMX-NDEPHWFRSA-N |
SMILES | CC(=O)OCNC(=O)CNC(=O)C(CC1=CC=CC=C1)NC(=O)CNC(=O)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Reference | [1]. Yunsheng Huang, et al. Exatecan derivatives and their applications. |