For research use only. Not for therapeutic Use.
Fmoc-N-Me-Arg(pbf)-OH (Cat.No:M014270) is a chemically modified arginine derivative used in peptide synthesis. The Fmoc group serves as a protective unit, allowing selective reactions during peptide assembly. The N-Me modification refers to a methyl group on the arginine amino group, and pbf (2,2,4,6,7-pentamethyldihydrobenzofuran-5-sulfonyl) is a protecting group for the guanidino function of arginine. This compound facilitates controlled peptide synthesis for research and pharmaceutical purposes.
Catalog Number | M014270 |
CAS Number | 913733-27-4 |
Synonyms | Fmoc-N-Me-Arg(pbf)-OH;N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-N2-methyl-L-ornithine;(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-5-(3-((2,2,4,6,7-pentameth |
Molecular Formula | C35H42N4O7S |
Purity | ≥95% |
Storage | -20°C |
InChIKey | AXPMRTFXKPJFIB-PMERELPUSA-N |
SMILES | CC1=C2C(=C(C(=C1C)S(=O)(=O)NNC=NCCCC(C(=O)O)N(C)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C)CC(O2)(C)C |