For research use only. Not for therapeutic Use.
Fmoc-NH-PEG2-CH2CH2COOH(Cat No.:I016716) is a cleavable ADC linker employed in the construction of antibody-drug conjugates (ADCs). It acts as a bridge between the antibody and the drug payload, facilitating targeted delivery. Additionally, Fmoc-NH-PEG2-CH2CH2COOH can serve as a PEG-based PROTAC linker, enabling the synthesis of proteolysis-targeting chimeras (PROTACs). By connecting the target protein binder and the E3 ligase recruiter, it promotes the degradation of specific proteins. This versatile linker plays a crucial role in the development of both ADCs and PROTACs, offering precise targeting and controlled drug release in therapeutic applications.
CAS Number | 872679-70-4 |
Molecular Formula | C₂₂H₂₅NO₆ |
Purity | ≥95% |
Target | PROTAC |
Storage | 2-8°C |
IUPAC Name | 3-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]propanoic acid |
InChI | InChI=1S/C22H25NO6/c24-21(25)9-11-27-13-14-28-12-10-23-22(26)29-15-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,20H,9-15H2,(H,23,26)(H,24,25) |
InChIKey | QWHLFJJLRVOHTM-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCC(=O)O |
Reference | [1]. Fulcher JM, et al. Chemical synthesis of Shiga toxin subunit B using a next-generation traceless “helping hand” solubilizing tag. Org Biomol Chem. 2019 Dec 28;17(48):10237-10244. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |