For research use only. Not for therapeutic Use.
Fmoc-NH-PEG5-CH2COOH(Cat No.:I016908) is a cleavable linker commonly employed in the synthesis of antibody-drug conjugates (ADCs). It acts as a connector between the antibody and the cytotoxic drug, enabling targeted delivery. Additionally, Fmoc-NH-PEG5-CH2COOH can serve as a PEG-based PROTAC linker in the synthesis of PROTACs (PROteolysis TArgeting Chimeras). As a PROTAC linker, it facilitates the connection between the target protein and the E3 ligase, leading to selective protein degradation.
Catalog Number | I016908 |
CAS Number | 635287-26-2 |
Molecular Formula | C₂₇H₃₅NO₉ |
Purity | ≥95% |
Target | PROTAC |
Storage | 2-8°C |
IUPAC Name | 2-[2-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C27H35NO9/c29-26(30)20-36-18-17-35-16-15-34-14-13-33-12-11-32-10-9-28-27(31)37-19-25-23-7-3-1-5-21(23)22-6-2-4-8-24(22)25/h1-8,25H,9-20H2,(H,28,31)(H,29,30) |
InChIKey | LNIFRTLAPAPKAG-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCOCCOCCOCC(=O)O |
Reference | [1]. Liuhong CHEN, et al. Multimeric bicyclic peptide ligands. WO2019162682A1. |