For research use only. Not for therapeutic Use.
Fmoc-Phe-OH-d5（Cat No.:I043820）is a stable isotope-labeled derivative of Fmoc-phenylalanine, where the “d5” denotes the incorporation of five deuterium atoms (a heavier isotope of hydrogen). This compound is commonly used in peptide synthesis, particularly in applications requiring precise quantification and tracking of peptides in biological systems. The deuterium labeling allows for the differentiation of Fmoc-Phe-OH-d5 from naturally occurring phenylalanine during mass spectrometry or NMR studies. It is valuable in metabolic studies, proteomics, and pharmacokinetic research, enabling detailed investigations of peptide metabolism, distribution, and interactions within living organisms.
| CAS Number | 225918-67-2 |
| Synonyms | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| Molecular Formula | C24H16D5NO4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChI | InChI=1S/C24H21NO4/c26-23(27)22(14-16-8-2-1-3-9-16)25-24(28)29-15-21-19-12-6-4-10-17(19)18-11-5-7-13-20(18)21/h1-13,21-22H,14-15H2,(H,25,28)(H,26,27)/t22-/m0/s1/i1D,2D,3D,8D,9D |
| InChIKey | SJVFAHZPLIXNDH-XFTMQEPESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
