For research use only. Not for therapeutic Use.
Fmoc-piperazine hydrochloride(CAT: L046279) is a piperazine derivative with an Fmoc (9-fluorenylmethoxycarbonyl) protecting group, commonly used in peptide synthesis and medicinal chemistry. The Fmoc group protects the piperazine nitrogen, allowing for selective deprotection and functionalization in solid-phase peptide synthesis (SPPS) or solution-phase synthesis. This compound is particularly valuable for introducing piperazine into peptide chains or other bioactive molecules, where piperazine often serves as a linker or scaffold for pharmacologically active compounds. Fmoc-piperazine hydrochloride is essential in developing complex peptides, peptidomimetics, and drug candidates, offering stability and ease of handling in synthetic chemistry workflows.
CAS Number | 215190-22-0 |
Molecular Formula | C19H21ClN2O2 |
Purity | ≥95% |
IUPAC Name | 9H-fluoren-9-ylmethyl piperazine-1-carboxylate;hydrochloride |
InChI | InChI=1S/C19H20N2O2.ClH/c22-19(21-11-9-20-10-12-21)23-13-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18;/h1-8,18,20H,9-13H2;1H |
InChIKey | IXWMXZSFRQQDDO-UHFFFAOYSA-N |