For research use only. Not for therapeutic Use.
Fmoc-Pro-Pro-OH(Cat No.:L046278)is a dipeptide consisting of two proline residues protected by an Fmoc (fluorenylmethyloxycarbonyl) group at the N-terminus. It is widely used in peptide synthesis, particularly in the development of proline-rich peptides, which are important in various biological processes and therapeutic applications. The Fmoc group provides stability during peptide chain elongation, allowing for selective deprotection and further coupling reactions. Fmoc-Pro-Pro-OH is essential in the design of peptides with structural and functional significance, contributing to advancements in medicinal chemistry and drug development.
CAS Number | 129223-22-9 |
Molecular Formula | C25H26N2O5 |
Purity | ≥95% |
IUPAC Name | (2S)-1-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C25H26N2O5/c28-23(26-13-6-12-22(26)24(29)30)21-11-5-14-27(21)25(31)32-15-20-18-9-3-1-7-16(18)17-8-2-4-10-19(17)20/h1-4,7-10,20-22H,5-6,11-15H2,(H,29,30)/t21-,22-/m0/s1 |
InChIKey | VRAQFWSWKRNOGU-VXKWHMMOSA-N |
SMILES | C1CC(N(C1)C(=O)C2CCCN2C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |