For research use only. Not for therapeutic Use.
Fmoc-S-3-amino-4,4-diphenyl-butyric acid(Cat No.:I042997)is a compound used in peptide synthesis and organic chemistry. It consists of an amino acid derivative with an Fmoc (9-fluorenylmethoxycarbonyl) protecting group, which is commonly used in solid-phase peptide synthesis to protect the amino group of amino acids. The diphenylbutyric acid side chain adds bulk and structural rigidity to the peptide, allowing for the study of specific interactions in biochemical research. This compound is useful in designing peptides with particular structural or functional properties, such as those for drug development or enzyme inhibition studies.
CAS Number | 332062-08-5 |
Synonyms | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid |
Molecular Formula | C31H27NO4 |
Purity | ≥95% |
IUPAC Name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4,4-diphenylbutanoic acid |
InChI | InChI=1S/C31H27NO4/c33-29(34)19-28(30(21-11-3-1-4-12-21)22-13-5-2-6-14-22)32-31(35)36-20-27-25-17-9-7-15-23(25)24-16-8-10-18-26(24)27/h1-18,27-28,30H,19-20H2,(H,32,35)(H,33,34)/t28-/m0/s1 |
InChIKey | GQRZIYGFRVKFSB-NDEPHWFRSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@H](CC(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |