For research use only. Not for therapeutic Use.
Fmoc-Val-Ala-PAB(Cat No.:I014387), also known as Fmoc-Val-Ala-PAB-OH, is a valuable linker used in the synthesis of Antibody-Drug Conjugates (ADCs). This linker plays a crucial role in connecting the drug payload to the antibody component in ADCs, allowing for targeted drug delivery. Fmoc-Val-Ala-PAB provides stability and controlled release properties, ensuring the drug is released at the desired site of action. Its compatibility with standard peptide synthesis methods makes it a versatile tool in the development of ADCs for improved therapeutic efficacy in cancer treatment.
CAS Number | 1394238-91-5 |
Synonyms | Fmoc-Val-Ala-PAB; ACD linker; Fmoc-Val-Ala-PAB-OH;(9H-fluoren-9-yl)methyl (S)-1-((S)-1-(4-(hydroxymethyl)phenylamino)-1-oxopropan-2-ylamino)-3-methyl-1-oxobutan-2-ylcarbamate |
Molecular Formula | C30H33N3O5 |
Purity | ≥95% |
Target | ADC Linker |
Solubility | Soluble in DMSO |
IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
InChI | InChI=1S/C30H33N3O5/c1-18(2)27(29(36)31-19(3)28(35)32-21-14-12-20(16-34)13-15-21)33-30(37)38-17-26-24-10-6-4-8-22(24)23-9-5-7-11-25(23)26/h4-15,18-19,26-27,34H,16-17H2,1-3H3,(H,31,36)(H,32,35)(H,33,37)/t19-,27-/m0/s1 |
InChIKey | PIEQFKSWCKVBTP-PPHZAIPVSA-N |
SMILES | CC(C)C(C(=O)NC(C)C(=O)NC1=CC=C(C=C1)CO)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |