For research use only. Not for therapeutic Use.
Fodipir（Cat No.:M017595）is a high-purity, phosphorus-containing ligand used primarily in pharmaceutical research and diagnostic imaging. It acts as a chelating agent, forming stable complexes with metal ions, notably manganese, enhancing MRI contrast for better imaging of tissues and organs. Fodipir’s precise chelation properties make it vital for studying metal ion interactions in biological systems. Its applications extend to developing novel diagnostic agents and improving existing imaging techniques. This versatile compound is essential for advanced research in medical imaging and diagnostic chemistry.
| Catalog Number | M017595 |
| CAS Number | 118248-91-2 |
| Synonyms | 2-[2-[carboxymethyl-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridin-4-yl]methyl]amino]ethyl-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridin-4-yl]methyl]amino]acetic acid |
| Molecular Formula | C22H32N4O14P2 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[carboxymethyl-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridin-4-yl]methyl]amino]ethyl-[[3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridin-4-yl]methyl]amino]acetic acid |
| InChI | InChI=1S/C22H32N4O14P2/c1-13-21(31)17(15(5-23-13)11-39-41(33,34)35)7-25(9-19(27)28)3-4-26(10-20(29)30)8-18-16(12-40-42(36,37)38)6-24-14(2)22(18)32/h5-6,31-32H,3-4,7-12H2,1-2H3,(H,27,28)(H,29,30)(H2,33,34,35)(H2,36,37,38) |
| InChIKey | SQKUFYLUXROIFM-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=C1O)CN(CCN(CC2=C(C(=NC=C2COP(=O)(O)O)C)O)CC(=O)O)CC(=O)O)COP(=O)(O)O |
