For research use only. Not for therapeutic Use.
Folic acid-13C5(Cat No.:S000559) is a specialized form of folic acid, a water-soluble B vitamin vital for DNA synthesis, cell division, and red blood cell production. The “13C5” notation indicates that five carbon atoms in the folic acid molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling enables precise tracking of folic acid metabolism and its involvement in various biochemical pathways using advanced analytical techniques like mass spectrometry. Folic acid-13C5 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to folic acid deficiency or metabolism, such as neural tube defects.
CAS Number | 1207282-75-4 |
Molecular Formula | C1413C5H19N7O6 |
Purity | ≥95% |
IUPAC Name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioic acid |
InChI | InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/i5+1,6+1,12+1,13+1,18+1 |
InChIKey | OVBPIULPVIDEAO-BCTWCYHZSA-N |
SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |