Folic acid-13C5,15N（Cat No.:S000563） is an isotopically labeled form of folic acid, a B vitamin essential for DNA synthesis and cellular growth. The “13C5,15N” notation indicates that five carbon atoms and all nitrogen atoms in the folic acid molecule are replaced with the stable isotopes carbon-13 and nitrogen-15, respectively. This isotopic labeling enables precise tracing of folic acid metabolism and its incorporation into biochemical pathways using advanced analytical techniques like mass spectrometry. Folic acid-13C5,15N serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to folic acid deficiency or metabolism, such as neural tube defects.
| Catalog Number | S000563 |
| CAS Number | 2687960-47-8 |
| Molecular Formula | C1413C5H19N615NO6 |
| Purity | 95% |
| IUPAC Name | (2S)-2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl](15N)amino](1,2,3,4,5-13C5)pentanedioic acid |
| InChI | InChI=1S/C19H19N7O6/c20-19-25-15-14(17(30)26-19)23-11(8-22-15)7-21-10-3-1-9(2-4-10)16(29)24-12(18(31)32)5-6-13(27)28/h1-4,8,12,21H,5-7H2,(H,24,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t12-/m0/s1/i5+1,6+1,12+1,13+1,18+1,24+1 |
| InChIKey | OVBPIULPVIDEAO-JKYNXJBRSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
