For research use only. Not for therapeutic Use.
Fonadelpar (Cat.No:I006828) is an investigational drug that belongs to the class of peroxisome proliferator-activated receptor delta (PPARδ) agonists. It is being studied for its potential in treating metabolic disorders such as dyslipidemia and non-alcoholic fatty liver disease (NAFLD). Fonadelpar’s mechanism of action involves activating PPARδ, which plays a role in regulating lipid metabolism and glucose homeostasis.
| Catalog Number | I006828 |
| CAS Number | 515138-06-4 |
| Synonyms | NPS-005; SJP-0035; NPS005; SJP0035; NPS 005; SJP 0035;2-((3-(2-(4-isopropyl-2-(4-(trifluoromethyl)phenyl)thiazol-5-yl)ethyl)-5-methylbenzo[d]isoxazol-6-yl)oxy)acetic acid |
| Molecular Formula | C25H23F3N2O4S |
| Purity | ≥95% |
| Target | peroxisome proliferator activated receptor δ agonist |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| IUPAC Name | 2-[[5-methyl-3-[2-[4-propan-2-yl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-5-yl]ethyl]-1,2-benzoxazol-6-yl]oxy]acetic acid |
| InChI | InChI=1S/C25H23F3N2O4S/c1-13(2)23-21(35-24(29-23)15-4-6-16(7-5-15)25(26,27)28)9-8-18-17-10-14(3)19(33-12-22(31)32)11-20(17)34-30-18/h4-7,10-11,13H,8-9,12H2,1-3H3,(H,31,32) |
| InChIKey | WWKYLBGQYALEDL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=C1)C(=NO2)CCC3=C(N=C(S3)C4=CC=C(C=C4)C(F)(F)F)C(C)C)OCC(=O)O |
