For research use only. Not for therapeutic Use.
Formononetin(Cat No.:I003709)is a natural isoflavonoid found in various plants, particularly in red clover, known for its diverse pharmacological properties. It exhibits anti-inflammatory, antioxidant, and anticancer activities, making it a potential therapeutic agent for managing various diseases. Formononetin is a phytoestrogen, meaning it can mimic estrogen, and has been studied for its potential in hormone-related conditions like osteoporosis and breast cancer. Additionally, it shows promise in cardiovascular protection by improving lipid metabolism and reducing oxidative stress. Formononetin’s wide range of biological effects makes it an attractive subject for ongoing research.
CAS Number | 485-72-3 |
Synonyms | Biochanin B;NSC 93360 |
Molecular Formula | C16H12O4 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: 200 mg/mL |
Storage | 3 years -20℃ powder |
IUPAC Name | 7-hydroxy-3-(4-methoxyphenyl)chromen-4-one |
InChI | InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3 |
InChIKey | HKQYGTCOTHHOMP-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O |
Reference | <p style=/line-height:25px/> <br>[2]. Zhang X, et al. Formononetin induces apoptosis in PC-3 prostate cancer cells through enhancing the Bax/Bcl-2 ratios and regulating the p38/Akt pathway. Nutr Cancer. 2014;66(4):656-61. <br>[3]. Chen J, et al. Formononetin induces cell cycle arrest of human breast cancer cells via IGF1/PI3K/Akt pathways in vitro and in vivo. Horm Metab Res. 2011 Sep;43(10):681-6. </p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |