For research use only. Not for therapeutic Use.
Formycin triphosphate(Cat No.:M086849) is a nucleotide analog derived from formycin, a nucleoside mimicking adenosine. Structurally, it incorporates a formycin base linked to a triphosphate group. This compound is of interest primarily in biochemical research involving nucleic acids due to its ability to interact with enzymes that process adenosine triphosphate (ATP). It has potential applications in studying mechanisms of RNA and DNA synthesis, as well as probing the activity of various ATP-dependent enzymes. Additionally, its unique structure allows it to be used in investigations of viral replication and enzyme inhibition.
CAS Number | 16409-13-5 |
Synonyms | formycin triphosphate |
Molecular Formula | C10H16N5O13P3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [[(2R,3S,4R,5S)-5-(7-amino-2H-pyrazolo[4,3-d]pyrimidin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
InChI | InChI=1S/C10H16N5O13P3/c11-10-6-4(12-2-13-10)5(14-15-6)9-8(17)7(16)3(26-9)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-3,7-9,16-17H,1H2,(H,14,15)(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/t3-,7-,8-,9+/m1/s1 |
InChIKey | DCMOKHVROIRMGQ-KSYZLYKTSA-N |
SMILES | C1=NC2=C(NN=C2C(=N1)N)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |