For research use only. Not for therapeutic Use.
Fosaprepitant (Cat.No:I002246) is a prodrug of aprepitant, an antiemetic medication used to prevent and treat chemotherapy-induced nausea and vomiting. Fosaprepitant is administered intravenously and is rapidly converted to aprepitant in the body. It works by blocking the action of substance P, a neurotransmitter involved in the vomiting reflex.
| Catalog Number | I002246 |
| CAS Number | 172673-20-0 |
| Synonyms | [5-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-3-oxo-1H-1,2,4-triazol-2-yl]phosphonic acid |
| Molecular Formula | C₂₃H₂₂F₇N₄O₆P |
| Purity | ≥95% |
| Target | Substance P/NK1 Receptor |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20℃ |
| IUPAC Name | [3-[[(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholin-4-yl]methyl]-5-oxo-4H-1,2,4-triazol-1-yl]phosphonic acid |
| InChI | InChI=1S/C23H22F7N4O6P/c1-12(14-8-15(22(25,26)27)10-16(9-14)23(28,29)30)40-20-19(13-2-4-17(24)5-3-13)33(6-7-39-20)11-18-31-21(35)34(32-18)41(36,37)38/h2-5,8-10,12,19-20H,6-7,11H2,1H3,(H,31,32,35)(H2,36,37,38)/t12-,19+,20-/m1/s1 |
| InChIKey | BARDROPHSZEBKC-OITMNORJSA-N |
| SMILES | CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)OC2C(N(CCO2)CC3=NC(=O)N(N3)P(=O)(O)O)C4=CC=C(C=C4)F |
| Reference | <p style=/line-height:25px/> |
