For research use only. Not for therapeutic Use.
FOY 251（Cat No.:R007309）is a potent serine protease inhibitor, widely used in research for its ability to inhibit enzymes such as trypsin, kallikrein, and thrombin. This compound, also known as nafamostat mesylate, has anticoagulant and anti-inflammatory properties, making it valuable for studying coagulation pathways and inflammatory processes. FOY 251 is also investigated for its potential in treating conditions like pancreatitis and in organ preservation solutions. Its stability and specificity make it a trusted choice for applications in pharmacology and biochemical research, especially in enzyme inhibition studies.
| Catalog Number | R007309 |
| CAS Number | 71079-09-9 |
| Synonyms | 4-[[4-[(Aminoiminomethyl)amino]benzoyl]oxy]-benzeneacetic Acid Monomethanesulfonate; |
| Molecular Formula | C17H19N3O7S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]acetic acid;methanesulfonic acid |
| InChI | InChI=1S/C16H15N3O4.CH4O3S/c17-16(18)19-12-5-3-11(4-6-12)15(22)23-13-7-1-10(2-8-13)9-14(20)21;1-5(2,3)4/h1-8H,9H2,(H,20,21)(H4,17,18,19);1H3,(H,2,3,4) |
| InChIKey | JXMOPIDYHUYOED-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CC=C1CC(=O)O)OC(=O)C2=CC=C(C=C2)N=C(N)N |
