For research use only. Not for therapeutic Use.
FPFS-1169 HCl is a chemical compound, potentially a research chemical or a pharmaceutical agent, typically provided in its hydrochloride salt form to enhance its stability and solubility. While specific details about FPFS-1169 HCl might be scarce, compounds like this are often involved in studies related to pharmacology, drug development, or other specialized biochemical research. The HCl designation indicates that the compound is in its hydrochloride form, which is commonly used in drug formulations to improve absorption and bioavailability. The precise applications and properties of FPFS-1169 HCl would depend on the context of its use in research or therapeutic development.
| Catalog Number | I006860 |
| CAS Number | 265130-22-1 (HCl) |
| Synonyms | FPFS-1169 hydrochloride; FPFS-1169 HCl; FPFS 1169; FPFS1169; BPAP-cpd; R-(-)-BPAP; R-FPFS-1169;(R)-1-(benzofuran-2-yl)-N-propylpentan-2-amine hydrochloride |
| Molecular Formula | C16H24ClNO |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| SMILES | CCC[C@@H](NCCC)CC1=CC2=CC=CC=C2O1.[H]Cl |
