For research use only. Not for therapeutic Use.
FPFS-1169 HCl(Cat No.:I006860)is an investigational compound studied for its potential therapeutic applications, particularly in the field of oncology. It is a small molecule that is being explored for its ability to inhibit specific proteins or pathways involved in cancer cell proliferation, survival, and metastasis. FPFS-1169 HCl is thought to work by modulating key molecular targets in tumor cells, potentially enhancing the effectiveness of existing cancer treatments. Ongoing research is focused on evaluating its safety, pharmacokinetics, and efficacy in preclinical and clinical trials to determine its role in cancer therapy.
CAS Number | 265130-22-1 (HCl) |
Synonyms | FPFS-1169 hydrochloride; FPFS-1169 HCl; FPFS 1169; FPFS1169; BPAP-cpd; R-(-)-BPAP; R-FPFS-1169;(R)-1-(benzofuran-2-yl)-N-propylpentan-2-amine hydrochloride |
Molecular Formula | C16H24ClNO |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | 0 - 4°C for short term or -20 °C for long term |
IUPAC Name | (2R)-1-(1-benzofuran-2-yl)-N-propylpentan-2-amine;hydrochloride |
InChI | InChI=1S/C16H23NO.ClH/c1-3-7-14(17-10-4-2)12-15-11-13-8-5-6-9-16(13)18-15;/h5-6,8-9,11,14,17H,3-4,7,10,12H2,1-2H3;1H/t14-;/m1./s1 |
InChIKey | GKKNDWKXWAVGOK-PFEQFJNWSA-N |
SMILES | CCC[C@H](CC1=CC2=CC=CC=C2O1)NCCC.Cl |