For research use only. Not for therapeutic Use.
FPR2 Agonist 2（Cat No.:I043884）is a selective small molecule that activates the formyl peptide receptor 2 (FPR2), a G-protein-coupled receptor involved in immune responses, inflammation, and wound healing. FPR2 plays a role in regulating neutrophil chemotaxis and modulating the immune system’s response to infections and tissue damage. By binding to FPR2, Agonist 2 can potentially enhance anti-inflammatory effects and promote tissue repair. It is being investigated for therapeutic applications in inflammatory diseases, such as rheumatoid arthritis, and for its ability to modulate immune cell activity, offering potential in immunotherapy and regenerative medicine.
| CAS Number | 2829263-20-7 |
| Synonyms | 1-[(2S)-3-(4-cyanophenyl)-1-(5-fluoro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-(4-fluorophenyl)urea |
| Molecular Formula | C25H20F2N4O2 |
| Purity | ≥95% |
| IUPAC Name | 1-[(2S)-3-(4-cyanophenyl)-1-(5-fluoro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]-3-(4-fluorophenyl)urea |
| InChI | InChI=1S/C25H20F2N4O2/c26-19-5-8-21(9-6-19)29-25(33)30-22(13-16-1-3-17(15-28)4-2-16)24(32)31-12-11-18-14-20(27)7-10-23(18)31/h1-10,14,22H,11-13H2,(H2,29,30,33)/t22-/m0/s1 |
| InChIKey | KCNMTQVKKFREAN-QFIPXVFZSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)F)C(=O)[C@H](CC3=CC=C(C=C3)C#N)NC(=O)NC4=CC=C(C=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
