For research use only. Not for therapeutic Use.
FPTQ (4-(2-Fluorophenyl)-1,2,4-triazolo[4,3-a]quinoxaline) is a heterocyclic compound often used in neuroscience research due to its activity as a selective antagonist of the AMPA receptor, a subtype of glutamate receptors in the brain. By inhibiting AMPA receptors, FPTQ plays a role in modulating excitatory neurotransmission, making it valuable for studying neurological disorders, including epilepsy, neurodegeneration, and cognitive dysfunction. Researchers explore FPTQ for its potential therapeutic applications in targeting overactive glutamatergic signaling pathways in these conditions.
| Catalog Number | I005191 |
| CAS Number | 864863-72-9 |
| Molecular Formula | C17H12FN5 |
| Purity | ≥95% |
| Target | mGluR1 |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20C powder |
| IC50 | 6 nM |
| IUPAC Name | 6-[1-(2-fluoropyridin-3-yl)-5-methyltriazol-4-yl]quinoline |
| InChI | InChI=1S/C17H12FN5/c1-11-16(13-6-7-14-12(10-13)4-2-8-19-14)21-22-23(11)15-5-3-9-20-17(15)18/h2-10H,1H3 |
| InChIKey | RTUBNVSZHGWRCV-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=C(N=CC=C2)F)C3=CC4=C(C=C3)N=CC=C4 |
