For research use only. Not for therapeutic Use.
FQI1 (Cat.No:I012627) is a small molecule inhibitor that selectively targets the transcription factor MYC, a protein involved in the regulation of cell growth and division. By inhibiting MYC, FQI1 suppresses the growth of cancer cells and has shown promising antitumor effects in preclinical studies. Further research is ongoing to assess its potential as an anticancer therapeutic.
Catalog Number | I012627 |
CAS Number | 599151-35-6 |
Synonyms | 8-(2-Ethoxyphenyl)-7,8-dihydro-1,3-dioxolo[4,5-g]quinolin-6(5H)-one; 8-(2-Ethoxy-phenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one; factor quinolinone inhibitor 1 |
Molecular Formula | C18H17NO4 |
Purity | ≥95% |
IUPAC Name | 8-(2-ethoxyphenyl)-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-6-one |
InChI | InChI=1S/C18H17NO4/c1-2-21-15-6-4-3-5-11(15)12-8-18(20)19-14-9-17-16(7-13(12)14)22-10-23-17/h3-7,9,12H,2,8,10H2,1H3,(H,19,20) |
InChIKey | YKSYGLXHLSPWLB-UHFFFAOYSA-N |
SMILES | CCOC1=CC=CC=C1C2CC(=O)NC3=CC4=C(C=C23)OCO4 |