For research use only. Not for therapeutic Use.
FR-167653（Cat No.:I000003）is a potent inhibitor of p38 MAPK, specifically targeting the p38α and p38β isoforms. It is known for its strong anti-inflammatory and anti-fibrotic properties, making it a valuable compound in research on diseases driven by inflammation, such as rheumatoid arthritis and pulmonary fibrosis. By inhibiting p38 MAPK, FR-167653 reduces the production of pro-inflammatory cytokines and helps prevent tissue damage in models of inflammatory diseases. Additionally, it has been investigated for its potential to mitigate fibrosis in various organ systems, including the liver and lungs.
| Catalog Number | I000003 |
| CAS Number | 158876-66-5 |
| Synonyms | 7-(4-FLUOROPHENYL)-1,2,3,4-TETRAHYDRO-2-(OXOPHENYLACETYL)-8-(4-PYRIDINYL)-PYRAZOLO[5,1-C][1,2,4]TRIAZINE SULFATE |
| Molecular Formula | C24H20FN5O6S |
| Purity | ≥95% |
| Target | Autophagy |
| Storage | -20°C |
| IUPAC Name | 1-[7-(4-fluorophenyl)-8-pyridin-4-yl-3,4-dihydro-1H-pyrazolo[5,1-c][1,2,4]triazin-2-yl]-2-phenylethane-1,2-dione;sulfuric acid |
| InChI | InChI=1S/C24H18FN5O2.H2O4S/c25-19-8-6-17(7-9-19)21-20(16-10-12-26-13-11-16)23-28-30(15-14-29(23)27-21)24(32)22(31)18-4-2-1-3-5-18;1-5(2,3)4/h1-13,28H,14-15H2;(H2,1,2,3,4) |
| InChIKey | KCPHXRBKBLJJJJ-UHFFFAOYSA-N |
| SMILES | C1CN(NC2=C(C(=NN21)C3=CC=C(C=C3)F)C4=CC=NC=C4)C(=O)C(=O)C5=CC=CC=C5.OS(=O)(=O)O |
| Reference | 1: Hattori S, Dhar DK, Hara N, Tonomoto Y, Onoda T, Ono T, Yamanoi A, Tachibana <br> 3: Matsuoka H, Arai T, Mori M, Goya S, Kida H, Morishita H, Fujiwara H, Tachibana <br> |
