For research use only. Not for therapeutic Use.
FR194921（Cat No.:I006879）is an investigational small molecule inhibitor being developed for the treatment of cancer and autoimmune diseases. It targets the mitogen-activated protein kinase (MAPK) pathway, which plays a crucial role in regulating cell growth, survival, and inflammation. By inhibiting key enzymes in the MAPK signaling pathway, FR194921 aims to disrupt tumor cell proliferation and reduce immune system dysregulation in autoimmune conditions. Preclinical studies have shown promising results, particularly in cancers with MAPK pathway activation. Ongoing clinical trials are assessing its safety, efficacy, and potential as a targeted therapy for various cancers and autoimmune diseases.
| CAS Number | 202646-80-8 |
| Synonyms | 2-(1-methylpiperidin-4-yl)-6-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyridazin-3-one |
| Molecular Formula | C23H23N5O |
| Purity | ≥95% |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)-6-(2-phenylpyrazolo[1,5-a]pyridin-3-yl)pyridazin-3-one |
| InChI | InChI=1S/C23H23N5O/c1-26-15-12-18(13-16-26)28-21(29)11-10-19(24-28)22-20-9-5-6-14-27(20)25-23(22)17-7-3-2-4-8-17/h2-11,14,18H,12-13,15-16H2,1H3 |
| InChIKey | YHDRUTMZCJZJAL-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)N2C(=O)C=CC(=N2)C3=C4C=CC=CN4N=C3C5=CC=CC=C5 |
