For research use only. Not for therapeutic Use.
FR901464(Cat No.:M019956) is a natural compound initially isolated from the bacterium Pseudomonas sp. No. 2663. It exhibits potent anticancer properties by selectively inhibiting splicing factor 3b, a critical component of the spliceosome involved in pre-mRNA splicing. This disruption affects RNA processing, leading to selective cytotoxicity in tumor cells. Due to its unique mechanism of action, FR901464 has been the subject of intense research for developing new cancer therapies. Its derivatives, like spliceostatin A, further explore its potential in clinical settings, targeting various cancers with specific genetic and molecular profiles.
CAS Number | 146478-72-0 |
Synonyms | FR901464;WB 2663B |
Molecular Formula | C27H41NO8 |
Purity | ≥95% |
Documentation | |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | [(Z,2S)-5-[[(2R,3R,5S,6S)-6-[(2E,4E)-5-[(3R,4R,5R,7S)-4,7-dihydroxy-7-methyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
InChI | InChI=1S/C27H41NO8/c1-16(8-11-23-25(31)27(15-33-27)14-26(6,32)36-23)7-10-22-17(2)13-21(19(4)35-22)28-24(30)12-9-18(3)34-20(5)29/h7-9,11-12,17-19,21-23,25,31-32H,10,13-15H2,1-6H3,(H,28,30)/b11-8+,12-9-,16-7+/t17-,18-,19+,21+,22-,23+,25+,26-,27+/m0/s1 |
InChIKey | PJKVJJDQXZARCA-QHYZBLTGSA-N |
SMILES | CC1CC(C(OC1CC=C(C)C=CC2C(C3(CC(O2)(C)O)CO3)O)C)NC(=O)C=CC(C)OC(=O)C |
Reference | 1: Ghosh AK, Chen ZH, Effenberger KA, Jurica MS. Enantioselective total syntheses 2: He HY, Tang MC, Zhang F, Tang GL. Cis-Double bond formation by thioesterase 3: Ghosh AK, Chen ZH. Enantioselective syntheses of FR901464 and spliceostatin A: 4: Liu X, Biswas S, Tang GL, Cheng YQ. Isolation and characterization of 5: Fan L, Lagisetti C, Edwards CC, Webb TR, Potter PM. Sudemycins, novel small 6: Zhang F, He HY, Tang MC, Tang YM, Zhou Q, Tang GL. Cloning and elucidation of 7: Osman S, Albert BJ, Wang Y, Li M, Czaicki NL, Koide K. Structural requirements |