For research use only. Not for therapeutic Use.
Frabuprofen（Cat No.:I027793）is a nonsteroidal anti-inflammatory drug (NSAID) that is a derivative of ibuprofen, designed to offer similar pain-relieving and anti-inflammatory effects. Like ibuprofen, frabuprofen works by inhibiting cyclooxygenase (COX) enzymes, which are responsible for producing prostaglandins that promote inflammation, pain, and fever. It is typically used to treat conditions like arthritis, muscle pain, and minor injuries. Frabuprofen is developed to have a potentially improved pharmacokinetic profile, such as better absorption or fewer side effects, compared to conventional ibuprofen. However, more research is needed to confirm its efficacy and safety in clinical settings.
| Catalog Number | I027793 |
| CAS Number | 86696-88-0 |
| Synonyms | Frabuprofen |
| Molecular Formula | C26H33F3N2O2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| InChI | InChI=1S/C26H33F3N2O2/c1-19(2)17-21-7-9-22(10-8-21)20(3)25(32)33-16-15-30-11-13-31(14-12-30)24-6-4-5-23(18-24)26(27,28)29/h4-10,18-20H,11-17H2,1-3H3 |
| InChIKey | ROZHWGHNJMGUJH-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C(C)C(=O)OCCN2CCN(CC2)C3=CC=CC(=C3)C(F)(F)F |
